C21H15Cl4NO7S — CID 126184662
[2-(2,4-dichlorophenyl)-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate (PubChem CID 126184662) has the molecular formula C21H15Cl4NO7S and a molecular weight of 567.23 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 126184662 |
| Molecular Formula | C21H15Cl4NO7S |
| Molecular Weight | 567.23 g/mol |
| Exact Mass | 564.93 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
| SMILES | CS(=O)(=O)CC[C@@H](C(=O)OCC(=O)c1ccc(Cl)cc1Cl)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C21H15Cl4NO7S/c1-34(31,32)5-4-17(21(30)33-9-18(27)11-3-2-10(22)6-14(11)23)26-19(28)12-7-15(24)16(25)8-13(12)20(26)29/h2-3,6-8,17H,4-5,9H2,1H3/t17-/m0/s1 |
| InChIKey | HELDEHOYNJGGAR-KRWDZBQOSA-N |
| XLogP | 4.13 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|