C17H22N2O5S — CID 20905838
2-(4-methylsulfonyl-1-morpholin-4-yl-1-oxobutan-2-yl)-3H-isoindol-1-one (PubChem CID 20905838) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-(4-methylsulfonyl-1-morpholin-4-yl-1-oxobutan-2-yl)-3H-isoindol-1-one.
| Compound Name | 2-(4-methylsulfonyl-1-morpholin-4-yl-1-oxobutan-2-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 20905838 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-(4-methylsulfonyl-1-morpholin-4-yl-1-oxobutan-2-yl)-3H-isoindol-1-one |
| SMILES | CS(=O)(=O)CCC(C(=O)N1CCOCC1)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C17H22N2O5S/c1-25(22,23)11-6-15(17(21)18-7-9-24-10-8-18)19-12-13-4-2-3-5-14(13)16(19)20/h2-5,15H,6-12H2,1H3 |
| InChIKey | HTERYSZSCCKOHC-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |