C32H31IN4O8S — CID 70604280
2-iodoethyl 2-[2-[benzamido(benzoyl)sulfinamoyl]-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 70604280) has the molecular formula C32H31IN4O8S and a molecular weight of 758.59 g/mol. Its IUPAC name is 2-iodoethyl 2-[2-[benzamido(benzoyl)sulfinamoyl]-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | 2-iodoethyl 2-[2-[benzamido(benzoyl)sulfinamoyl]-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 70604280 |
| Molecular Formula | C32H31IN4O8S |
| Molecular Weight | 758.59 g/mol |
| Exact Mass | 758.09 |
| IUPAC Name | 2-iodoethyl 2-[2-[benzamido(benzoyl)sulfinamoyl]-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)C(C(=O)OCCI)N1C(=O)C(NC(=O)COc2ccccc2)C1S(=O)N(NC(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C32H31IN4O8S/c1-21(2)27(32(42)44-19-18-33)36-30(41)26(34-25(38)20-45-24-16-10-5-11-17-24)31(36)46(43)37(29(40)23-14-8-4-9-15-23)35-28(39)22-12-6-3-7-13-22/h3-17,26-27,31H,1,18-20H2,2H3,(H,34,38)(H,35,39) |
| InChIKey | KKAQCXFRFBIHMD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.59 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|