C16H16Cl4N2O5S2 — CID 21314484
2,2,2-trichloroethyl 2-[2-chlorosulfinyl-4-oxo-3-[(2-thiophen-2-ylacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 21314484) has the molecular formula C16H16Cl4N2O5S2 and a molecular weight of 522.26 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[2-chlorosulfinyl-4-oxo-3-[(2-thiophen-2-ylacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | 2,2,2-trichloroethyl 2-[2-chlorosulfinyl-4-oxo-3-[(2-thiophen-2-ylacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 21314484 |
| Molecular Formula | C16H16Cl4N2O5S2 |
| Molecular Weight | 522.26 g/mol |
| Exact Mass | 519.93 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[2-chlorosulfinyl-4-oxo-3-[(2-thiophen-2-ylacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)C(C(=O)OCC(Cl)(Cl)Cl)N1C(=O)C(NC(=O)Cc2cccs2)C1S(=O)Cl |
| InChI | InChI=1S/C16H16Cl4N2O5S2/c1-8(2)12(15(25)27-7-16(17,18)19)22-13(24)11(14(22)29(20)26)21-10(23)6-9-4-3-5-28-9/h3-5,11-12,14H,1,6-7H2,2H3,(H,21,23) |
| InChIKey | RLMFDIJSWMDLEQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|