C12H17NO5S — CID 56634238
methyl 2-[(2R,3S)-2-acetylsulfanyl-3-methoxy-4-oxoazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 56634238) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is methyl 2-[(2R,3S)-2-acetylsulfanyl-3-methoxy-4-oxoazetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | methyl 2-[(2R,3S)-2-acetylsulfanyl-3-methoxy-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 56634238 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | methyl 2-[(2R,3S)-2-acetylsulfanyl-3-methoxy-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | COC(=O)C(=C(C)C)N1C(=O)[C@H](OC)[C@H]1SC(C)=O |
| InChI | InChI=1S/C12H17NO5S/c1-6(2)8(12(16)18-5)13-10(15)9(17-4)11(13)19-7(3)14/h9,11H,1-5H3/t9-,11+/m0/s1 |
| InChIKey | UFVNGSSHYJJUQP-GXSJLCMTSA-N |
| XLogP | 0.92 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|