C22H23N3O4S3 — CID 118001359
methyl (2S)-2-[[(2S)-2-acetamido-3-(1,3-benzothiazol-2-yldisulfanyl)propanoyl]amino]-3-phenylpropanoate (PubChem CID 118001359) has the molecular formula C22H23N3O4S3 and a molecular weight of 489.64 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-acetamido-3-(1,3-benzothiazol-2-yldisulfanyl)propanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-acetamido-3-(1,3-benzothiazol-2-yldisulfanyl)propanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 118001359 |
| Molecular Formula | C22H23N3O4S3 |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-acetamido-3-(1,3-benzothiazol-2-yldisulfanyl)propanoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](CSSc1nc2ccccc2s1)NC(C)=O |
| InChI | InChI=1S/C22H23N3O4S3/c1-14(26)23-18(13-30-32-22-25-16-10-6-7-11-19(16)31-22)20(27)24-17(21(28)29-2)12-15-8-4-3-5-9-15/h3-11,17-18H,12-13H2,1-2H3,(H,23,26)(H,24,27)/t17-,18+/m0/s1 |
| InChIKey | AYFSRJGZOKAJGM-ZWKOTPCHSA-N |
| XLogP | 3.44 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|