C22H30N2O5S2Si — CID 150281166
O-[(4-nitrophenyl)methyl] (5R,6S)-3-ethyl-7-oxo-6-[(1R)-1-pentylsilyloxyethyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carbothioate (PubChem CID 150281166) has the molecular formula C22H30N2O5S2Si and a molecular weight of 494.71 g/mol. Its IUPAC name is O-[(4-nitrophenyl)methyl] (5R,6S)-3-ethyl-7-oxo-6-[(1R)-1-pentylsilyloxyethyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carbothioate.
| Compound Name | O-[(4-nitrophenyl)methyl] (5R,6S)-3-ethyl-7-oxo-6-[(1R)-1-pentylsilyloxyethyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carbothioate |
|---|---|
| PubChem CID | 150281166 |
| Molecular Formula | C22H30N2O5S2Si |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | O-[(4-nitrophenyl)methyl] (5R,6S)-3-ethyl-7-oxo-6-[(1R)-1-pentylsilyloxyethyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carbothioate |
| SMILES | CCCCC[SiH2]O[C@H](C)[C@H]1C(=O)N2C(C(=S)OCc3ccc([N+](=O)[O-])cc3)=C(CC)S[C@H]12 |
| InChI | InChI=1S/C22H30N2O5S2Si/c1-4-6-7-12-32-29-14(3)18-20(25)23-19(17(5-2)31-21(18)23)22(30)28-13-15-8-10-16(11-9-15)24(26)27/h8-11,14,18,21H,4-7,12-13,32H2,1-3H3/t14-,18+,21-/m1/s1 |
| InChIKey | GFPMKPZCSNHRDO-YMTYPPQLSA-N |
| XLogP | 4.69 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|