C22H18N2O4S2 — CID 54134690
(4-nitrophenyl)methyl (5S)-6-benzylidene-3-ethyl-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 54134690) has the molecular formula C22H18N2O4S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5S)-6-benzylidene-3-ethyl-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5S)-6-benzylidene-3-ethyl-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54134690 |
| Molecular Formula | C22H18N2O4S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | (4-nitrophenyl)methyl (5S)-6-benzylidene-3-ethyl-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CCC1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=S)C(=Cc3ccccc3)[C@@H]2S1 |
| InChI | InChI=1S/C22H18N2O4S2/c1-2-18-19(22(25)28-13-15-8-10-16(11-9-15)24(26)27)23-20(29)17(21(23)30-18)12-14-6-4-3-5-7-14/h3-12,21H,2,13H2,1H3/t21-/m0/s1 |
| InChIKey | NWVQZWLJJMENOO-NRFANRHFSA-N |
| XLogP | 5.06 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|