C24H19N3O12S — CID 154413451
(4-nitrophenyl)methyl (5R)-3-[[2-[(4-nitrophenyl)methoxycarbonyloxy]acetyl]oxymethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 154413451) has the molecular formula C24H19N3O12S and a molecular weight of 573.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R)-3-[[2-[(4-nitrophenyl)methoxycarbonyloxy]acetyl]oxymethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R)-3-[[2-[(4-nitrophenyl)methoxycarbonyloxy]acetyl]oxymethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154413451 |
| Molecular Formula | C24H19N3O12S |
| Molecular Weight | 573.49 g/mol |
| Exact Mass | 573.07 |
| IUPAC Name | (4-nitrophenyl)methyl (5R)-3-[[2-[(4-nitrophenyl)methoxycarbonyloxy]acetyl]oxymethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | O=C(COC(=O)OCc1ccc([N+](=O)[O-])cc1)OCC1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C[C@H]2S1 |
| InChI | InChI=1S/C24H19N3O12S/c28-19-9-20-25(19)22(23(30)37-10-14-1-5-16(6-2-14)26(32)33)18(40-20)12-36-21(29)13-39-24(31)38-11-15-3-7-17(8-4-15)27(34)35/h1-8,20H,9-13H2/t20-/m1/s1 |
| InChIKey | SIHHRWZBXACWGQ-HXUWFJFHSA-N |
| XLogP | 2.96 |
| TPSA | 194.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|