C15H12N6O5S — CID 70532252
(4-nitrophenyl)methyl (5R)-7-oxo-3-(tetrazol-1-ylmethyl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 70532252) has the molecular formula C15H12N6O5S and a molecular weight of 388.37 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R)-7-oxo-3-(tetrazol-1-ylmethyl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R)-7-oxo-3-(tetrazol-1-ylmethyl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70532252 |
| Molecular Formula | C15H12N6O5S |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | (4-nitrophenyl)methyl (5R)-7-oxo-3-(tetrazol-1-ylmethyl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)C1=C(Cn2cnnn2)S[C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C15H12N6O5S/c22-12-5-13-20(12)14(11(27-13)6-19-8-16-17-18-19)15(23)26-7-9-1-3-10(4-2-9)21(24)25/h1-4,8,13H,5-7H2/t13-/m1/s1 |
| InChIKey | SYNWYWTYNIECAZ-CYBMUJFWSA-N |
| XLogP | 0.84 |
| TPSA | 133.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|