C18H16N2O7S2 — CID 70487285
(4-nitrophenyl)methyl (5R)-3-[(E)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 70487285) has the molecular formula C18H16N2O7S2 and a molecular weight of 436.47 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R)-3-[(E)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R)-3-[(E)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70487285 |
| Molecular Formula | C18H16N2O7S2 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | (4-nitrophenyl)methyl (5R)-3-[(E)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CCOC(=O)/C=C/SC1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C[C@H]2S1 |
| InChI | InChI=1S/C18H16N2O7S2/c1-2-26-15(22)7-8-28-18-16(19-13(21)9-14(19)29-18)17(23)27-10-11-3-5-12(6-4-11)20(24)25/h3-8,14H,2,9-10H2,1H3/b8-7+/t14-/m1/s1 |
| InChIKey | FYQVRVDPMGMIGT-HSBSLETESA-N |
| XLogP | 2.92 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|