C18H13N3O5S2 — CID 54317360
(4-nitrophenyl)methyl (5S)-7-oxo-3-pyridin-2-ylsulfanyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 54317360) has the molecular formula C18H13N3O5S2 and a molecular weight of 415.45 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5S)-7-oxo-3-pyridin-2-ylsulfanyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5S)-7-oxo-3-pyridin-2-ylsulfanyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54317360 |
| Molecular Formula | C18H13N3O5S2 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | (4-nitrophenyl)methyl (5S)-7-oxo-3-pyridin-2-ylsulfanyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)C1=C(Sc2ccccn2)S[C@H]2CC(=O)N12 |
| InChI | InChI=1S/C18H13N3O5S2/c22-14-9-15-20(14)16(18(28-15)27-13-3-1-2-8-19-13)17(23)26-10-11-4-6-12(7-5-11)21(24)25/h1-8,15H,9-10H2/t15-/m0/s1 |
| InChIKey | SPDXUKNXFJRURV-HNNXBMFYSA-N |
| XLogP | 3.30 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|