C27H22N4O6S — CID 154413454
(4-nitrophenyl)methyl (5R)-7-oxo-3-[4-(2-pyridin-2-ylethylcarbamoyl)phenyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 154413454) has the molecular formula C27H22N4O6S and a molecular weight of 530.56 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R)-7-oxo-3-[4-(2-pyridin-2-ylethylcarbamoyl)phenyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R)-7-oxo-3-[4-(2-pyridin-2-ylethylcarbamoyl)phenyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154413454 |
| Molecular Formula | C27H22N4O6S |
| Molecular Weight | 530.56 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | (4-nitrophenyl)methyl (5R)-7-oxo-3-[4-(2-pyridin-2-ylethylcarbamoyl)phenyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)C1=C(c2ccc(C(=O)NCCc3ccccn3)cc2)S[C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C27H22N4O6S/c32-22-15-23-30(22)24(27(34)37-16-17-4-10-21(11-5-17)31(35)36)25(38-23)18-6-8-19(9-7-18)26(33)29-14-12-20-3-1-2-13-28-20/h1-11,13,23H,12,14-16H2,(H,29,33)/t23-/m1/s1 |
| InChIKey | SLFGMWHFYAREFR-HSZRJFAPSA-N |
| XLogP | 3.68 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|