C16H11F3N2O6S2 — CID 70433768
(4-nitrophenyl)methyl (5R)-7-oxo-3-(3,3,3-trifluoro-2-oxopropyl)sulfanyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 70433768) has the molecular formula C16H11F3N2O6S2 and a molecular weight of 448.40 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R)-7-oxo-3-(3,3,3-trifluoro-2-oxopropyl)sulfanyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R)-7-oxo-3-(3,3,3-trifluoro-2-oxopropyl)sulfanyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70433768 |
| Molecular Formula | C16H11F3N2O6S2 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | (4-nitrophenyl)methyl (5R)-7-oxo-3-(3,3,3-trifluoro-2-oxopropyl)sulfanyl-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)C1=C(SCC(=O)C(F)(F)F)S[C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C16H11F3N2O6S2/c17-16(18,19)10(22)7-28-15-13(20-11(23)5-12(20)29-15)14(24)27-6-8-1-3-9(4-2-8)21(25)26/h1-4,12H,5-7H2/t12-/m1/s1 |
| InChIKey | JKWKVPJBZJSSBO-GFCCVEGCSA-N |
| XLogP | 2.98 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|