C17H15N5O5 — CID 131715753
(4-nitrophenyl)methyl (5R)-3-(4-methyltriazol-1-yl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 131715753) has the molecular formula C17H15N5O5 and a molecular weight of 369.34 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R)-3-(4-methyltriazol-1-yl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R)-3-(4-methyltriazol-1-yl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 131715753 |
| Molecular Formula | C17H15N5O5 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (4-nitrophenyl)methyl (5R)-3-(4-methyltriazol-1-yl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | Cc1cn(C2=C(C(=O)OCc3ccc([N+](=O)[O-])cc3)N3C(=O)C[C@H]3C2)nn1 |
| InChI | InChI=1S/C17H15N5O5/c1-10-8-20(19-18-10)14-6-13-7-15(23)21(13)16(14)17(24)27-9-11-2-4-12(5-3-11)22(25)26/h2-5,8,13H,6-7,9H2,1H3/t13-/m1/s1 |
| InChIKey | IFOXTCQNOLDPDN-CYBMUJFWSA-N |
| XLogP | 1.41 |
| TPSA | 120.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|