C18H18N2O9 — CID 154507171
1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl (5S)-4-hydroxy-3-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 154507171) has the molecular formula C18H18N2O9 and a molecular weight of 406.35 g/mol. Its IUPAC name is 1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl (5S)-4-hydroxy-3-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | 1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl (5S)-4-hydroxy-3-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154507171 |
| Molecular Formula | C18H18N2O9 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl (5S)-4-hydroxy-3-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)OC(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C[C@H]2C1O |
| InChI | InChI=1S/C18H18N2O9/c1-9-15(19-13(16(9)22)7-14(19)21)17(23)28-10(2)29-18(24)27-8-11-3-5-12(6-4-11)20(25)26/h3-6,10,13,16,22H,7-8H2,1-2H3/t10?,13-,16?/m0/s1 |
| InChIKey | MBFRSYOUUCQDQW-QCIACWGRSA-N |
| XLogP | 1.39 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|