C24H22N4O8S — CID 154428815
(4S,5R,6S)-3-[7-(2-hydroxyacetyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 154428815) has the molecular formula C24H22N4O8S and a molecular weight of 526.53 g/mol. Its IUPAC name is (4S,5R,6S)-3-[7-(2-hydroxyacetyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4S,5R,6S)-3-[7-(2-hydroxyacetyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154428815 |
| Molecular Formula | C24H22N4O8S |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | (4S,5R,6S)-3-[7-(2-hydroxyacetyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(c3cn4cnc(C(=O)CO)c4s3)[C@](C)(Cc3ccc([N+](=O)[O-])cc3)[C@@H]12 |
| InChI | InChI=1S/C24H22N4O8S/c1-11(30)16-20-24(2,7-12-3-5-13(6-4-12)28(35)36)17(19(23(33)34)27(20)21(16)32)15-8-26-10-25-18(14(31)9-29)22(26)37-15/h3-6,8,10-11,16,20,29-30H,7,9H2,1-2H3,(H,33,34)/t11-,16-,20-,24+/m1/s1 |
| InChIKey | DBPGACRQFCKKML-YZGPAUDESA-N |
| XLogP | 1.75 |
| TPSA | 175.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|