C28H27N2O9P — CID 11238402
(4-nitrophenyl)methyl (5R,6S)-3-diphenoxyphosphoryloxy-6-[(1R)-1-hydroxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 11238402) has the molecular formula C28H27N2O9P and a molecular weight of 566.50 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R,6S)-3-diphenoxyphosphoryloxy-6-[(1R)-1-hydroxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R,6S)-3-diphenoxyphosphoryloxy-6-[(1R)-1-hydroxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 11238402 |
| Molecular Formula | C28H27N2O9P |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | (4-nitrophenyl)methyl (5R,6S)-3-diphenoxyphosphoryloxy-6-[(1R)-1-hydroxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1CN2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(OP(=O)(Oc3ccccc3)Oc3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C28H27N2O9P/c1-19(31)24-17-29-25(24)16-26(27(29)28(32)36-18-20-12-14-21(15-13-20)30(33)34)39-40(35,37-22-8-4-2-5-9-22)38-23-10-6-3-7-11-23/h2-15,19,24-25,31H,16-18H2,1H3/t19-,24-,25-/m1/s1 |
| InChIKey | FXRDQGPNRZCDTD-UKDVSSAZSA-N |
| XLogP | 5.22 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|