C30H25N6O10P — CID 155613640
(4-nitrobenzoyl) (4R,5R,6S)-3-diphenoxyphosphoryloxy-4-methyl-7-oxo-6-[(1R)-1-(tetrazol-1-yl)ethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 155613640) has the molecular formula C30H25N6O10P and a molecular weight of 660.54 g/mol. Its IUPAC name is (4-nitrobenzoyl) (4R,5R,6S)-3-diphenoxyphosphoryloxy-4-methyl-7-oxo-6-[(1R)-1-(tetrazol-1-yl)ethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrobenzoyl) (4R,5R,6S)-3-diphenoxyphosphoryloxy-4-methyl-7-oxo-6-[(1R)-1-(tetrazol-1-yl)ethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 155613640 |
| Molecular Formula | C30H25N6O10P |
| Molecular Weight | 660.54 g/mol |
| Exact Mass | 660.14 |
| IUPAC Name | (4-nitrobenzoyl) (4R,5R,6S)-3-diphenoxyphosphoryloxy-4-methyl-7-oxo-6-[(1R)-1-(tetrazol-1-yl)ethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C[C@H]([C@H]1C(=O)N2C(C(=O)OC(=O)c3ccc([N+](=O)[O-])cc3)=C(OP(=O)(Oc3ccccc3)Oc3ccccc3)[C@H](C)[C@H]12)n1cnnn1 |
| InChI | InChI=1S/C30H25N6O10P/c1-18-25-24(19(2)34-17-31-32-33-34)28(37)35(25)26(30(39)43-29(38)20-13-15-21(16-14-20)36(40)41)27(18)46-47(42,44-22-9-5-3-6-10-22)45-23-11-7-4-8-12-23/h3-19,24-25H,1-2H3/t18-,19-,24-,25-/m1/s1 |
| InChIKey | OSMWNCJJQPQAGM-PIYXRGFCSA-N |
| XLogP | 4.50 |
| TPSA | 195.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|