C33H30N7O11P — CID 157077985
(4-nitrobenzoyl) (4R)-3-diphenoxyphosphoryloxy-4-methyl-6-[(1R)-1-[[2-(5-methyltetrazol-1-yl)acetyl]amino]ethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 157077985) has the molecular formula C33H30N7O11P and a molecular weight of 731.62 g/mol. Its IUPAC name is (4-nitrobenzoyl) (4R)-3-diphenoxyphosphoryloxy-4-methyl-6-[(1R)-1-[[2-(5-methyltetrazol-1-yl)acetyl]amino]ethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrobenzoyl) (4R)-3-diphenoxyphosphoryloxy-4-methyl-6-[(1R)-1-[[2-(5-methyltetrazol-1-yl)acetyl]amino]ethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 157077985 |
| Molecular Formula | C33H30N7O11P |
| Molecular Weight | 731.62 g/mol |
| Exact Mass | 731.17 |
| IUPAC Name | (4-nitrobenzoyl) (4R)-3-diphenoxyphosphoryloxy-4-methyl-6-[(1R)-1-[[2-(5-methyltetrazol-1-yl)acetyl]amino]ethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | Cc1nnnn1CC(=O)N[C@H](C)C1C(=O)N2C(C(=O)OC(=O)c3ccc([N+](=O)[O-])cc3)=C(OP(=O)(Oc3ccccc3)Oc3ccccc3)[C@H](C)C12 |
| InChI | InChI=1S/C33H30N7O11P/c1-19-28-27(20(2)34-26(41)18-38-21(3)35-36-37-38)31(42)39(28)29(33(44)48-32(43)22-14-16-23(17-15-22)40(45)46)30(19)51-52(47,49-24-10-6-4-7-11-24)50-25-12-8-5-9-13-25/h4-17,19-20,27-28H,18H2,1-3H3,(H,34,41)/t19-,20-,27?,28?/m1/s1 |
| InChIKey | NWKWARCZEGICNA-YVXWMLCYSA-N |
| XLogP | 3.75 |
| TPSA | 224.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.62 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|