C26H29N5O6 — CID 59215750
(4-nitrobenzoyl) (4S,5R,6R)-4-methyl-3-[[methyl-[(5-methylpyrazin-2-yl)methyl]amino]methyl]-7-oxo-6-propan-2-yl-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 59215750) has the molecular formula C26H29N5O6 and a molecular weight of 507.55 g/mol. Its IUPAC name is (4-nitrobenzoyl) (4S,5R,6R)-4-methyl-3-[[methyl-[(5-methylpyrazin-2-yl)methyl]amino]methyl]-7-oxo-6-propan-2-yl-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrobenzoyl) (4S,5R,6R)-4-methyl-3-[[methyl-[(5-methylpyrazin-2-yl)methyl]amino]methyl]-7-oxo-6-propan-2-yl-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 59215750 |
| Molecular Formula | C26H29N5O6 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | (4-nitrobenzoyl) (4S,5R,6R)-4-methyl-3-[[methyl-[(5-methylpyrazin-2-yl)methyl]amino]methyl]-7-oxo-6-propan-2-yl-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | Cc1cnc(CN(C)CC2=C(C(=O)OC(=O)c3ccc([N+](=O)[O-])cc3)N3C(=O)[C@H](C(C)C)[C@H]3[C@H]2C)cn1 |
| InChI | InChI=1S/C26H29N5O6/c1-14(2)21-22-16(4)20(13-29(5)12-18-11-27-15(3)10-28-18)23(30(22)24(21)32)26(34)37-25(33)17-6-8-19(9-7-17)31(35)36/h6-11,14,16,21-22H,12-13H2,1-5H3/t16-,21+,22+/m0/s1 |
| InChIKey | RIXQAVBMTHOEOB-KNXBSLHKSA-N |
| XLogP | 2.90 |
| TPSA | 135.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|