C28H27N5O7S — CID 59374402
(4-nitrobenzoyl) (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-[[pyridin-2-ylmethyl(1,3-thiazol-4-ylmethyl)amino]methyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 59374402) has the molecular formula C28H27N5O7S and a molecular weight of 577.62 g/mol. Its IUPAC name is (4-nitrobenzoyl) (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-[[pyridin-2-ylmethyl(1,3-thiazol-4-ylmethyl)amino]methyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrobenzoyl) (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-[[pyridin-2-ylmethyl(1,3-thiazol-4-ylmethyl)amino]methyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 59374402 |
| Molecular Formula | C28H27N5O7S |
| Molecular Weight | 577.62 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | (4-nitrobenzoyl) (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-[[pyridin-2-ylmethyl(1,3-thiazol-4-ylmethyl)amino]methyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)OC(=O)c3ccc([N+](=O)[O-])cc3)=C(CN(Cc3ccccn3)Cc3cscn3)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C28H27N5O7S/c1-16-22(13-31(12-20-14-41-15-30-20)11-19-5-3-4-10-29-19)25(32-24(16)23(17(2)34)26(32)35)28(37)40-27(36)18-6-8-21(9-7-18)33(38)39/h3-10,14-17,23-24,34H,11-13H2,1-2H3/t16-,17+,23+,24+/m0/s1 |
| InChIKey | FHRLIWQKTUNWBW-SMGXNKOPSA-N |
| XLogP | 2.94 |
| TPSA | 156.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.62 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|