C18H24BN4O4P — CID 89126635
CID 89126635 (PubChem CID 89126635) has the molecular formula C18H24BN4O4P and a molecular weight of 402.20 g/mol.
| Compound Name | CID 89126635 |
|---|---|
| PubChem CID | 89126635 |
| Molecular Formula | C18H24BN4O4P |
| Molecular Weight | 402.20 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | — |
| SMILES | [B]NPOC(=O)C1=C(CN(C)Cc2ccccn2)[C@H](C)[C@@H]2[C@@H]([C@@H](C)O)C(=O)N12 |
| InChI | InChI=1S/C18H24BN4O4P/c1-10-13(9-22(3)8-12-6-4-5-7-20-12)16(18(26)27-28-21-19)23-15(10)14(11(2)24)17(23)25/h4-7,10-11,14-15,21,24,28H,8-9H2,1-3H3/t10-,11+,14+,15+/m0/s1 |
| InChIKey | XENNOFMUUREJPG-RBDSIQFVSA-N |
| XLogP | 0.35 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|