C21H38BN4O6PSi — CID 89126603
CID 89126603 (PubChem CID 89126603) has the molecular formula C21H38BN4O6PSi and a molecular weight of 512.43 g/mol.
| Compound Name | CID 89126603 |
|---|---|
| PubChem CID | 89126603 |
| Molecular Formula | C21H38BN4O6PSi |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | — |
| SMILES | [B]NPOC(=O)C1=C(CN(C)CCNC(=O)O)[C@H](C)[C@@H]2[C@@H]([C@@H](C)O[Si](CC)(CC)CC)C(=O)N12 |
| InChI | InChI=1S/C21H38BN4O6PSi/c1-7-34(8-2,9-3)32-14(5)16-17-13(4)15(12-25(6)11-10-23-21(29)30)18(26(17)19(16)27)20(28)31-33-24-22/h13-14,16-17,23-24,33H,7-12H2,1-6H3,(H,29,30)/t13-,14+,16+,17+/m0/s1 |
| InChIKey | PVAQLSGMIFQIMX-XOSAIJSUSA-N |
| XLogP | 2.05 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|