C18H21BN3O6P — CID 88877816
CID 88877816 (PubChem CID 88877816) has the molecular formula C18H21BN3O6P and a molecular weight of 417.17 g/mol.
| Compound Name | CID 88877816 |
|---|---|
| PubChem CID | 88877816 |
| Molecular Formula | C18H21BN3O6P |
| Molecular Weight | 417.17 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | — |
| SMILES | [B]NPOC(=O)C1=C(COc2ccc(C(N)=O)cc2)[C@H](C)[C@@H]2[C@@H]([C@@H](C)O)C(=O)N12 |
| InChI | InChI=1S/C18H21BN3O6P/c1-8-12(7-27-11-5-3-10(4-6-11)16(20)24)15(18(26)28-29-21-19)22-14(8)13(9(2)23)17(22)25/h3-6,8-9,13-14,21,23,29H,7H2,1-2H3,(H2,20,24)/t8-,9+,13+,14+/m0/s1 |
| InChIKey | WFYKEPLRGSYZLD-NYHSCFHFSA-N |
| XLogP | 0.00 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.17 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|