C21H37BN3O4PSi — CID 89126633
CID 89126633 (PubChem CID 89126633) has the molecular formula C21H37BN3O4PSi and a molecular weight of 465.42 g/mol.
| Compound Name | CID 89126633 |
|---|---|
| PubChem CID | 89126633 |
| Molecular Formula | C21H37BN3O4PSi |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | — |
| SMILES | [B]NPOC(=O)C1=C(CN2CCCC2)[C@H](C)[C@@H]2[C@@H]([C@@H](C)O[Si](CC)(CC)CC)C(=O)N12 |
| InChI | InChI=1S/C21H37BN3O4PSi/c1-6-31(7-2,8-3)29-15(5)17-18-14(4)16(13-24-11-9-10-12-24)19(25(18)20(17)26)21(27)28-30-23-22/h14-15,17-18,23,30H,6-13H2,1-5H3/t14-,15+,17+,18+/m0/s1 |
| InChIKey | NMYVTCTUMQGUFP-BURFUSLBSA-N |
| XLogP | 2.95 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|