About CID 88875437
CID 88875437 (PubChem CID 88875437) has the molecular formula C21H37B2N5O6P2Si
and a molecular weight of 567.21 g/mol.
Molecular Properties
| Compound Name | CID 88875437 |
| PubChem CID | 88875437 |
| Molecular Formula | C21H37B2N5O6P2Si |
| Molecular Weight | 567.21 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | — |
| SMILES | [B]NPOC(=O)C1=C(CN2CC(NC3OP(N[B])O3)C2)[C@H](C)[C@@H]2C([C@@H](C)O[Si](CC)(CC)CC)C(=O)N12 |
| InChI | InChI=1S/C21H37B2N5O6P2Si/c1-6-37(7-2,8-3)34-13(5)16-17-12(4)15(18(28(17)19(16)29)20(30)31-35-25-22)11-27-9-14(10-27)24-21-32-36(26-23)33-21/h12-14,16-17,21,24-26,35H,6-11H2,1-5H3/t12-,13+,16?,17+,21?,36?/m0/s1 |
| InChIKey | HGDLBUNVDDDHMU-AZDYVRMJSA-N |
| XLogP | 1.36 |
| TPSA | 113.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 567.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 88875437 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88875437?
The IUPAC name of CID 88875437 (CID 88875437) is not available.
What is the SMILES notation for CID 88875437?
The canonical SMILES for CID 88875437 is [B]NPOC(=O)C1=C(CN2CC(NC3OP(N[B])O3)C2)[C@H](C)[C@@H]2C([C@@H](C)O[Si](CC)(CC)CC)C(=O)N12.
What is the InChIKey of CID 88875437?
The InChIKey is HGDLBUNVDDDHMU-AZDYVRMJSA-N. The full InChI is InChI=1S/C21H37B2N5O6P2Si/c1-6-37(7-2,8-3)34-13(5)16-17-12(4)15(18(28(17)19(16)29)20(30)31-35-25-22)11-27-9-14(10-27)24-21-32-36(26-23)33-21/h12-14,16-17,21,24-26,35H,6-11H2,1-5H3/t12-,13+,16?,17+,21?,36?/m0/s1.
What are the key properties of CID 88875437?
CID 88875437 has a molecular weight of 567.21 g/mol, XLogP of 1.36, 14 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88875437 is sourced from PubChem (CID 88875437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).