C21H37B2N5O6P2Si — CID 88875437
CID 88875437 (PubChem CID 88875437) has the molecular formula C21H37B2N5O6P2Si and a molecular weight of 567.21 g/mol.
| Compound Name | CID 88875437 |
|---|---|
| PubChem CID | 88875437 |
| Molecular Formula | C21H37B2N5O6P2Si |
| Molecular Weight | 567.21 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | — |
| SMILES | [B]NPOC(=O)C1=C(CN2CC(NC3OP(N[B])O3)C2)[C@H](C)[C@@H]2C([C@@H](C)O[Si](CC)(CC)CC)C(=O)N12 |
| InChI | InChI=1S/C21H37B2N5O6P2Si/c1-6-37(7-2,8-3)34-13(5)16-17-12(4)15(18(28(17)19(16)29)20(30)31-35-25-22)11-27-9-14(10-27)24-21-32-36(26-23)33-21/h12-14,16-17,21,24-26,35H,6-11H2,1-5H3/t12-,13+,16?,17+,21?,36?/m0/s1 |
| InChIKey | HGDLBUNVDDDHMU-AZDYVRMJSA-N |
| XLogP | 1.36 |
| TPSA | 113.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|