C30H42N4O8Si — CID 140611167
(4-nitrobenzoyl) (4S,5R,6S)-4-methyl-3-[[(3S)-3-(methylcarbamoyl)pyrrolidin-1-yl]methyl]-7-oxo-6-[(1R)-1-triethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 140611167) has the molecular formula C30H42N4O8Si and a molecular weight of 614.77 g/mol. Its IUPAC name is (4-nitrobenzoyl) (4S,5R,6S)-4-methyl-3-[[(3S)-3-(methylcarbamoyl)pyrrolidin-1-yl]methyl]-7-oxo-6-[(1R)-1-triethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrobenzoyl) (4S,5R,6S)-4-methyl-3-[[(3S)-3-(methylcarbamoyl)pyrrolidin-1-yl]methyl]-7-oxo-6-[(1R)-1-triethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 140611167 |
| Molecular Formula | C30H42N4O8Si |
| Molecular Weight | 614.77 g/mol |
| Exact Mass | 614.28 |
| IUPAC Name | (4-nitrobenzoyl) (4S,5R,6S)-4-methyl-3-[[(3S)-3-(methylcarbamoyl)pyrrolidin-1-yl]methyl]-7-oxo-6-[(1R)-1-triethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@H](C)[C@H]1C(=O)N2C(C(=O)OC(=O)c3ccc([N+](=O)[O-])cc3)=C(CN3CC[C@H](C(=O)NC)C3)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C30H42N4O8Si/c1-7-43(8-2,9-3)42-19(5)24-25-18(4)23(17-32-15-14-21(16-32)27(35)31-6)26(33(25)28(24)36)30(38)41-29(37)20-10-12-22(13-11-20)34(39)40/h10-13,18-19,21,24-25H,7-9,14-17H2,1-6H3,(H,31,35)/t18-,19+,21-,24+,25+/m0/s1 |
| InChIKey | BUOIULDSIMLMBV-HJBNWFOCSA-N |
| XLogP | 3.49 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.77 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|