C25H29N5O9 — CID 130434356
(4-nitrobenzoyl) (4S,5R)-3-[[(3S)-3-[(2-amino-2-oxoethyl)carbamoyl]pyrrolidin-1-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 130434356) has the molecular formula C25H29N5O9 and a molecular weight of 543.53 g/mol. Its IUPAC name is (4-nitrobenzoyl) (4S,5R)-3-[[(3S)-3-[(2-amino-2-oxoethyl)carbamoyl]pyrrolidin-1-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrobenzoyl) (4S,5R)-3-[[(3S)-3-[(2-amino-2-oxoethyl)carbamoyl]pyrrolidin-1-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 130434356 |
| Molecular Formula | C25H29N5O9 |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | (4-nitrobenzoyl) (4S,5R)-3-[[(3S)-3-[(2-amino-2-oxoethyl)carbamoyl]pyrrolidin-1-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C[C@@H](O)C1C(=O)N2C(C(=O)OC(=O)c3ccc([N+](=O)[O-])cc3)=C(CN3CC[C@H](C(=O)NCC(N)=O)C3)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C25H29N5O9/c1-12-17(11-28-8-7-15(10-28)22(33)27-9-18(26)32)21(29-20(12)19(13(2)31)23(29)34)25(36)39-24(35)14-3-5-16(6-4-14)30(37)38/h3-6,12-13,15,19-20,31H,7-11H2,1-2H3,(H2,26,32)(H,27,33)/t12-,13+,15-,19?,20+/m0/s1 |
| InChIKey | ARUVKZDAXDDEHN-DNYJEIKKSA-N |
| XLogP | -0.69 |
| TPSA | 202.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|