C29H37NO4S2Si — CID 70458224
phenylsulfanyl (4R,5S,6S)-3-benzylsulfanyl-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 70458224) has the molecular formula C29H37NO4S2Si and a molecular weight of 555.84 g/mol. Its IUPAC name is phenylsulfanyl (4R,5S,6S)-3-benzylsulfanyl-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | phenylsulfanyl (4R,5S,6S)-3-benzylsulfanyl-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70458224 |
| Molecular Formula | C29H37NO4S2Si |
| Molecular Weight | 555.84 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | phenylsulfanyl (4R,5S,6S)-3-benzylsulfanyl-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N2C(C(=O)OSc3ccccc3)=C(SCc3ccccc3)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C29H37NO4S2Si/c1-19-24-23(20(2)34-37(6,7)29(3,4)5)27(31)30(24)25(26(19)35-18-21-14-10-8-11-15-21)28(32)33-36-22-16-12-9-13-17-22/h8-17,19-20,23-24H,18H2,1-7H3/t19-,20?,23-,24-/m1/s1 |
| InChIKey | YXYDFLAZRVYDJW-SZLIAQGKSA-N |
| XLogP | 7.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.84 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|