C18H33NO2SeSi — CID 101480983
(3S,4R)-1-but-3-en-2-yl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-prop-2-enylselanylazetidin-2-one (PubChem CID 101480983) has the molecular formula C18H33NO2SeSi and a molecular weight of 402.51 g/mol. Its IUPAC name is (3S,4R)-1-but-3-en-2-yl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-prop-2-enylselanylazetidin-2-one.
| Compound Name | (3S,4R)-1-but-3-en-2-yl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-prop-2-enylselanylazetidin-2-one |
|---|---|
| PubChem CID | 101480983 |
| Molecular Formula | C18H33NO2SeSi |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (3S,4R)-1-but-3-en-2-yl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-prop-2-enylselanylazetidin-2-one |
| SMILES | C=CC[Se][C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1C(C)C=C |
| InChI | InChI=1S/C18H33NO2SeSi/c1-10-12-22-17-15(16(20)19(17)13(3)11-2)14(4)21-23(8,9)18(5,6)7/h10-11,13-15,17H,1-2,12H2,3-9H3/t13?,14-,15+,17-/m1/s1 |
| InChIKey | CRGSMFQCWRAWAD-UCMJJCQDSA-N |
| XLogP | 4.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|