C25H41NO5Si — CID 67690028
prop-2-enyl (1S,5R,8aS,8bR)-1-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-5-propan-2-yloxy-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate (PubChem CID 67690028) has the molecular formula C25H41NO5Si and a molecular weight of 463.69 g/mol. Its IUPAC name is prop-2-enyl (1S,5R,8aS,8bR)-1-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-5-propan-2-yloxy-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate.
| Compound Name | prop-2-enyl (1S,5R,8aS,8bR)-1-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-5-propan-2-yloxy-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
|---|---|
| PubChem CID | 67690028 |
| Molecular Formula | C25H41NO5Si |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | prop-2-enyl (1S,5R,8aS,8bR)-1-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-5-propan-2-yloxy-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
| SMILES | C=CCOC(=O)C1=C2[C@H](OC(C)C)CCC[C@@H]2[C@@H]2[C@@H](C(C)O[Si](C)(C)C(C)(C)C)C(=O)N12 |
| InChI | InChI=1S/C25H41NO5Si/c1-10-14-29-24(28)22-20-17(12-11-13-18(20)30-15(2)3)21-19(23(27)26(21)22)16(4)31-32(8,9)25(5,6)7/h10,15-19,21H,1,11-14H2,2-9H3/t16?,17-,18+,19+,21+/m0/s1 |
| InChIKey | CHVKYWMPQHPZDV-MCLKCESBSA-N |
| XLogP | 4.81 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|