C24H40N2O4SSi — CID 10814602
(1S,5S,8aS,8bR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-5-[[(3S)-pyrrolidin-3-yl]methylsulfanyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid (PubChem CID 10814602) has the molecular formula C24H40N2O4SSi and a molecular weight of 480.75 g/mol. Its IUPAC name is (1S,5S,8aS,8bR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-5-[[(3S)-pyrrolidin-3-yl]methylsulfanyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid.
| Compound Name | (1S,5S,8aS,8bR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-5-[[(3S)-pyrrolidin-3-yl]methylsulfanyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 10814602 |
| Molecular Formula | C24H40N2O4SSi |
| Molecular Weight | 480.75 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | (1S,5S,8aS,8bR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-5-[[(3S)-pyrrolidin-3-yl]methylsulfanyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N2C(C(=O)O)=C3[C@@H](SC[C@H]4CCNC4)CCC[C@@H]3[C@H]12 |
| InChI | InChI=1S/C24H40N2O4SSi/c1-14(30-32(5,6)24(2,3)4)18-20-16-8-7-9-17(31-13-15-10-11-25-12-15)19(16)21(23(28)29)26(20)22(18)27/h14-18,20,25H,7-13H2,1-6H3,(H,28,29)/t14-,15+,16+,17+,18-,20-/m1/s1 |
| InChIKey | LXSMCHOAZJQQAY-DGYXETDDSA-N |
| XLogP | 4.09 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.75 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|