C17H25NO4S2Si — CID 15238387
prop-2-enyl (1S,2S,3S)-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]-8,11-dithia-5-azatricyclo[5.4.0.02,5]undec-6-ene-6-carboxylate (PubChem CID 15238387) has the molecular formula C17H25NO4S2Si and a molecular weight of 399.61 g/mol. Its IUPAC name is prop-2-enyl (1S,2S,3S)-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]-8,11-dithia-5-azatricyclo[5.4.0.02,5]undec-6-ene-6-carboxylate.
| Compound Name | prop-2-enyl (1S,2S,3S)-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]-8,11-dithia-5-azatricyclo[5.4.0.02,5]undec-6-ene-6-carboxylate |
|---|---|
| PubChem CID | 15238387 |
| Molecular Formula | C17H25NO4S2Si |
| Molecular Weight | 399.61 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | prop-2-enyl (1S,2S,3S)-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]-8,11-dithia-5-azatricyclo[5.4.0.02,5]undec-6-ene-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C2SCCS[C@H]2[C@@H]2[C@@H]([C@@H](C)O[Si](C)(C)C)C(=O)N12 |
| InChI | InChI=1S/C17H25NO4S2Si/c1-6-7-21-17(20)13-15-14(23-8-9-24-15)12-11(16(19)18(12)13)10(2)22-25(3,4)5/h6,10-12,14H,1,7-9H2,2-5H3/t10-,11-,12+,14+/m1/s1 |
| InChIKey | MKYXYPUWYRUTNX-NMKXLXIOSA-N |
| XLogP | 2.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.61 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|