C26H33N3O8Si — CID 57271481
6-O-[(4-nitrophenyl)methyl] 11-O-prop-2-enyl (1S,2S,3S)-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]-5,11-diazatricyclo[5.4.0.02,5]undec-6-ene-6,11-dicarboxylate (PubChem CID 57271481) has the molecular formula C26H33N3O8Si and a molecular weight of 543.65 g/mol. Its IUPAC name is 6-O-[(4-nitrophenyl)methyl] 11-O-prop-2-enyl (1S,2S,3S)-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]-5,11-diazatricyclo[5.4.0.02,5]undec-6-ene-6,11-dicarboxylate.
| Compound Name | 6-O-[(4-nitrophenyl)methyl] 11-O-prop-2-enyl (1S,2S,3S)-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]-5,11-diazatricyclo[5.4.0.02,5]undec-6-ene-6,11-dicarboxylate |
|---|---|
| PubChem CID | 57271481 |
| Molecular Formula | C26H33N3O8Si |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 6-O-[(4-nitrophenyl)methyl] 11-O-prop-2-enyl (1S,2S,3S)-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]-5,11-diazatricyclo[5.4.0.02,5]undec-6-ene-6,11-dicarboxylate |
| SMILES | C=CCOC(=O)N1CCCC2=C(C(=O)OCc3ccc([N+](=O)[O-])cc3)N3C(=O)[C@H]([C@@H](C)O[Si](C)(C)C)[C@H]3[C@H]21 |
| InChI | InChI=1S/C26H33N3O8Si/c1-6-14-35-26(32)27-13-7-8-19-21(27)23-20(16(2)37-38(3,4)5)24(30)28(23)22(19)25(31)36-15-17-9-11-18(12-10-17)29(33)34/h6,9-12,16,20-21,23H,1,7-8,13-15H2,2-5H3/t16-,20-,21+,23+/m1/s1 |
| InChIKey | FVWHEPNBJVZGSF-VTUOOYILSA-N |
| XLogP | 3.76 |
| TPSA | 128.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|