C20H17N2NaO4 — CID 23666833
sodium (6S,7R,8S)-6-[(1R)-1-hydroxyethyl]-5-oxo-4,12-diazapentacyclo[9.8.0.02,8.04,7.013,18]nonadeca-1(19),2,11,13,15,17-hexaene-3-carboxylate (PubChem CID 23666833) has the molecular formula C20H17N2NaO4 and a molecular weight of 372.36 g/mol. Its IUPAC name is sodium (6S,7R,8S)-6-[(1R)-1-hydroxyethyl]-5-oxo-4,12-diazapentacyclo[9.8.0.02,8.04,7.013,18]nonadeca-1(19),2,11,13,15,17-hexaene-3-carboxylate.
| Compound Name | sodium (6S,7R,8S)-6-[(1R)-1-hydroxyethyl]-5-oxo-4,12-diazapentacyclo[9.8.0.02,8.04,7.013,18]nonadeca-1(19),2,11,13,15,17-hexaene-3-carboxylate |
|---|---|
| PubChem CID | 23666833 |
| Molecular Formula | C20H17N2NaO4 |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | sodium (6S,7R,8S)-6-[(1R)-1-hydroxyethyl]-5-oxo-4,12-diazapentacyclo[9.8.0.02,8.04,7.013,18]nonadeca-1(19),2,11,13,15,17-hexaene-3-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)[O-])=C3c4cc5ccccc5nc4CC[C@@H]3[C@H]12.[Na+] |
| InChI | InChI=1S/C20H18N2O4.Na/c1-9(23)15-17-11-6-7-14-12(8-10-4-2-3-5-13(10)21-14)16(11)18(20(25)26)22(17)19(15)24;/h2-5,8-9,11,15,17,23H,6-7H2,1H3,(H,25,26);/q;+1/p-1/t9-,11+,15-,17-;/m1./s1 |
| InChIKey | DJASJFVYJSSYOP-BOUPIVIISA-M |
| XLogP | -2.52 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |