C14H16F3NO5 — CID 67306965
(1S,5S,8aS,8bR)-5-methoxy-2-oxo-1-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid (PubChem CID 67306965) has the molecular formula C14H16F3NO5 and a molecular weight of 335.28 g/mol. Its IUPAC name is (1S,5S,8aS,8bR)-5-methoxy-2-oxo-1-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid.
| Compound Name | (1S,5S,8aS,8bR)-5-methoxy-2-oxo-1-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 67306965 |
| Molecular Formula | C14H16F3NO5 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (1S,5S,8aS,8bR)-5-methoxy-2-oxo-1-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
| SMILES | CO[C@H]1CCC[C@H]2C1=C(C(=O)O)N1C(=O)[C@H]([C@H](O)C(F)(F)F)[C@@H]21 |
| InChI | InChI=1S/C14H16F3NO5/c1-23-6-4-2-3-5-7(6)10(13(21)22)18-9(5)8(12(18)20)11(19)14(15,16)17/h5-6,8-9,11,19H,2-4H2,1H3,(H,21,22)/t5-,6-,8-,9+,11-/m0/s1 |
| InChIKey | RWHJSFZUPKCWGH-XSAHYXPGSA-N |
| XLogP | 0.90 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |