C14H19NO5S — CID 67691969
[(1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-5-methylsulfanyl-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindol-4-yl] hydrogen carbonate (PubChem CID 67691969) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is [(1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-5-methylsulfanyl-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindol-4-yl] hydrogen carbonate.
| Compound Name | [(1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-5-methylsulfanyl-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindol-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67691969 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | [(1S,5S,8aS,8bR)-1-(1-hydroxyethyl)-5-methylsulfanyl-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindol-4-yl] hydrogen carbonate |
| SMILES | CS[C@H]1CCC[C@H]2C1=C(OC(=O)O)N1C(=O)[C@H](C(C)O)[C@@H]21 |
| InChI | InChI=1S/C14H19NO5S/c1-6(16)9-11-7-4-3-5-8(21-2)10(7)13(20-14(18)19)15(11)12(9)17/h6-9,11,16H,3-5H2,1-2H3,(H,18,19)/t6?,7-,8-,9+,11+/m0/s1 |
| InChIKey | KKELMLUXCODJET-RWVIBHTCSA-N |
| XLogP | 1.65 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |