C27H28N2O8S2 — CID 88661581
(4-nitrophenyl)methyl 3-(2,2-dimethylpropanoylsulfanyl)-2-(2-oxo-4-prop-2-enylsulfinylazetidin-1-yl)-3-phenoxyprop-2-enoate (PubChem CID 88661581) has the molecular formula C27H28N2O8S2 and a molecular weight of 572.66 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-(2,2-dimethylpropanoylsulfanyl)-2-(2-oxo-4-prop-2-enylsulfinylazetidin-1-yl)-3-phenoxyprop-2-enoate.
| Compound Name | (4-nitrophenyl)methyl 3-(2,2-dimethylpropanoylsulfanyl)-2-(2-oxo-4-prop-2-enylsulfinylazetidin-1-yl)-3-phenoxyprop-2-enoate |
|---|---|
| PubChem CID | 88661581 |
| Molecular Formula | C27H28N2O8S2 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | (4-nitrophenyl)methyl 3-(2,2-dimethylpropanoylsulfanyl)-2-(2-oxo-4-prop-2-enylsulfinylazetidin-1-yl)-3-phenoxyprop-2-enoate |
| SMILES | C=CCS(=O)C1CC(=O)N1C(C(=O)OCc1ccc([N+](=O)[O-])cc1)=C(Oc1ccccc1)SC(=O)C(C)(C)C |
| InChI | InChI=1S/C27H28N2O8S2/c1-5-15-39(35)22-16-21(30)28(22)23(24(31)36-17-18-11-13-19(14-12-18)29(33)34)25(38-26(32)27(2,3)4)37-20-9-7-6-8-10-20/h5-14,22H,1,15-17H2,2-4H3 |
| InChIKey | CJWBJMRARLXVTG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|