C28H28ClN3O8S — CID 54454737
(4-nitrophenyl)methyl 2-[(2S,3S)-2-chloro-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]-3-[4-(cyanomethyl)phenoxy]-3-(2,2-dimethylpropanoylsulfanyl)prop-2-enoate (PubChem CID 54454737) has the molecular formula C28H28ClN3O8S and a molecular weight of 602.07 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2S,3S)-2-chloro-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]-3-[4-(cyanomethyl)phenoxy]-3-(2,2-dimethylpropanoylsulfanyl)prop-2-enoate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2S,3S)-2-chloro-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]-3-[4-(cyanomethyl)phenoxy]-3-(2,2-dimethylpropanoylsulfanyl)prop-2-enoate |
|---|---|
| PubChem CID | 54454737 |
| Molecular Formula | C28H28ClN3O8S |
| Molecular Weight | 602.07 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2S,3S)-2-chloro-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]-3-[4-(cyanomethyl)phenoxy]-3-(2,2-dimethylpropanoylsulfanyl)prop-2-enoate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N(C(C(=O)OCc2ccc([N+](=O)[O-])cc2)=C(Oc2ccc(CC#N)cc2)SC(=O)C(C)(C)C)[C@H]1Cl |
| InChI | InChI=1S/C28H28ClN3O8S/c1-16(33)21-23(29)31(24(21)34)22(25(35)39-15-18-5-9-19(10-6-18)32(37)38)26(41-27(36)28(2,3)4)40-20-11-7-17(8-12-20)13-14-30/h5-12,16,21,23,33H,13,15H2,1-4H3/t16-,21-,23-/m1/s1 |
| InChIKey | WXJUCSNIMSYCSQ-FQQGMQMYSA-N |
| XLogP | 4.66 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.07 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|