C35H36N2O8S2 — CID 54318038
(4-nitrophenyl)methyl 3-[4-(benzenecarbonothioyl)phenoxy]-2-[(2R,3S)-2-ethylsulfanyl-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]-5,5-dimethyl-4-oxohex-2-enoate (PubChem CID 54318038) has the molecular formula C35H36N2O8S2 and a molecular weight of 676.81 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-[4-(benzenecarbonothioyl)phenoxy]-2-[(2R,3S)-2-ethylsulfanyl-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]-5,5-dimethyl-4-oxohex-2-enoate.
| Compound Name | (4-nitrophenyl)methyl 3-[4-(benzenecarbonothioyl)phenoxy]-2-[(2R,3S)-2-ethylsulfanyl-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]-5,5-dimethyl-4-oxohex-2-enoate |
|---|---|
| PubChem CID | 54318038 |
| Molecular Formula | C35H36N2O8S2 |
| Molecular Weight | 676.81 g/mol |
| Exact Mass | 676.19 |
| IUPAC Name | (4-nitrophenyl)methyl 3-[4-(benzenecarbonothioyl)phenoxy]-2-[(2R,3S)-2-ethylsulfanyl-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]-5,5-dimethyl-4-oxohex-2-enoate |
| SMILES | CCS[C@@H]1[C@@H]([C@@H](C)O)C(=O)N1C(C(=O)OCc1ccc([N+](=O)[O-])cc1)=C(Oc1ccc(C(=S)c2ccccc2)cc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C35H36N2O8S2/c1-6-47-33-27(21(2)38)32(40)36(33)28(34(41)44-20-22-12-16-25(17-13-22)37(42)43)29(31(39)35(3,4)5)45-26-18-14-24(15-19-26)30(46)23-10-8-7-9-11-23/h7-19,21,27,33,38H,6,20H2,1-5H3/t21-,27+,33-/m1/s1 |
| InChIKey | SPQGPJOOHKTPON-LQBHKMHESA-N |
| XLogP | 6.23 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.81 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|