C22H26N2O6S2 — CID 56608686
3-(2-cyanophenoxy)-3-(2,2-dimethylpropanoylsulfanyl)-2-[(2R,3S)-2-ethylsulfanyl-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]prop-2-enoic acid (PubChem CID 56608686) has the molecular formula C22H26N2O6S2 and a molecular weight of 478.59 g/mol. Its IUPAC name is 3-(2-cyanophenoxy)-3-(2,2-dimethylpropanoylsulfanyl)-2-[(2R,3S)-2-ethylsulfanyl-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]prop-2-enoic acid.
| Compound Name | 3-(2-cyanophenoxy)-3-(2,2-dimethylpropanoylsulfanyl)-2-[(2R,3S)-2-ethylsulfanyl-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 56608686 |
| Molecular Formula | C22H26N2O6S2 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 3-(2-cyanophenoxy)-3-(2,2-dimethylpropanoylsulfanyl)-2-[(2R,3S)-2-ethylsulfanyl-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]prop-2-enoic acid |
| SMILES | CCS[C@@H]1[C@@H]([C@@H](C)O)C(=O)N1C(C(=O)O)=C(Oc1ccccc1C#N)SC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H26N2O6S2/c1-6-31-18-15(12(2)25)17(26)24(18)16(19(27)28)20(32-21(29)22(3,4)5)30-14-10-8-7-9-13(14)11-23/h7-10,12,15,18,25H,6H2,1-5H3,(H,27,28)/t12-,15+,18-/m1/s1 |
| InChIKey | FMWZSYZLLQNDNN-HNJNHCNJSA-N |
| XLogP | 3.42 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|