About (2-cyanophenyl) N-methyl-N-nitrosocarbamate
(2-cyanophenyl) N-methyl-N-nitrosocarbamate (PubChem CID 21316917) has the molecular formula C9H7N3O3
and a molecular weight of 205.17 g/mol. Its IUPAC name is (2-cyanophenyl) N-methyl-N-nitrosocarbamate.
Molecular Properties
| Compound Name | (2-cyanophenyl) N-methyl-N-nitrosocarbamate |
| PubChem CID | 21316917 |
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | (2-cyanophenyl) N-methyl-N-nitrosocarbamate |
| SMILES | CN(N=O)C(=O)Oc1ccccc1C#N |
| InChI | InChI=1S/C9H7N3O3/c1-12(11-14)9(13)15-8-5-3-2-4-7(8)6-10/h2-5H,1H3 |
| InChIKey | SGJXFMYSXRFERF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-cyanophenyl) N-methyl-N-nitrosocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyanophenyl) N-methyl-N-nitrosocarbamate?
The IUPAC name of (2-cyanophenyl) N-methyl-N-nitrosocarbamate (CID 21316917) is (2-cyanophenyl) N-methyl-N-nitrosocarbamate.
What is the SMILES notation for (2-cyanophenyl) N-methyl-N-nitrosocarbamate?
The canonical SMILES for (2-cyanophenyl) N-methyl-N-nitrosocarbamate is CN(N=O)C(=O)Oc1ccccc1C#N.
What is the InChIKey of (2-cyanophenyl) N-methyl-N-nitrosocarbamate?
The InChIKey is SGJXFMYSXRFERF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O3/c1-12(11-14)9(13)15-8-5-3-2-4-7(8)6-10/h2-5H,1H3.
What are the key properties of (2-cyanophenyl) N-methyl-N-nitrosocarbamate?
(2-cyanophenyl) N-methyl-N-nitrosocarbamate has a molecular weight of 205.17 g/mol, XLogP of 1.67, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanophenyl) N-methyl-N-nitrosocarbamate is sourced from PubChem (CID 21316917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).