About (2-cyanophenyl) N-(2-chloroethyl)carbamate
(2-cyanophenyl) N-(2-chloroethyl)carbamate (PubChem CID 13143938) has the molecular formula C10H9ClN2O2
and a molecular weight of 224.65 g/mol. Its IUPAC name is (2-cyanophenyl) N-(2-chloroethyl)carbamate.
Molecular Properties
| Compound Name | (2-cyanophenyl) N-(2-chloroethyl)carbamate |
| PubChem CID | 13143938 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (2-cyanophenyl) N-(2-chloroethyl)carbamate |
| SMILES | N#Cc1ccccc1OC(=O)NCCCl |
| InChI | InChI=1S/C10H9ClN2O2/c11-5-6-13-10(14)15-9-4-2-1-3-8(9)7-12/h1-4H,5-6H2,(H,13,14) |
| InChIKey | PNGVIKZULXHCHC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2-cyanophenyl) N-(2-chloroethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyanophenyl) N-(2-chloroethyl)carbamate?
The IUPAC name of (2-cyanophenyl) N-(2-chloroethyl)carbamate (CID 13143938) is (2-cyanophenyl) N-(2-chloroethyl)carbamate.
What is the SMILES notation for (2-cyanophenyl) N-(2-chloroethyl)carbamate?
The canonical SMILES for (2-cyanophenyl) N-(2-chloroethyl)carbamate is N#Cc1ccccc1OC(=O)NCCCl.
What is the InChIKey of (2-cyanophenyl) N-(2-chloroethyl)carbamate?
The InChIKey is PNGVIKZULXHCHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2O2/c11-5-6-13-10(14)15-9-4-2-1-3-8(9)7-12/h1-4H,5-6H2,(H,13,14).
What are the key properties of (2-cyanophenyl) N-(2-chloroethyl)carbamate?
(2-cyanophenyl) N-(2-chloroethyl)carbamate has a molecular weight of 224.65 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanophenyl) N-(2-chloroethyl)carbamate is sourced from PubChem (CID 13143938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).