C11H12N2O2 — CID 116819846
(2-methylphenyl) N-(2-cyanoethyl)carbamate (PubChem CID 116819846) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is (2-methylphenyl) N-(2-cyanoethyl)carbamate.
| Compound Name | (2-methylphenyl) N-(2-cyanoethyl)carbamate |
|---|---|
| PubChem CID | 116819846 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (2-methylphenyl) N-(2-cyanoethyl)carbamate |
| SMILES | Cc1ccccc1OC(=O)NCCC#N |
| InChI | InChI=1S/C11H12N2O2/c1-9-5-2-3-6-10(9)15-11(14)13-8-4-7-12/h2-3,5-6H,4,8H2,1H3,(H,13,14) |
| InChIKey | ZYUWUFMDPZCCCW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|