C12H14N2O4 — CID 116819885
(2,3-dimethoxyphenyl) N-(2-cyanoethyl)carbamate (PubChem CID 116819885) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl) N-(2-cyanoethyl)carbamate.
| Compound Name | (2,3-dimethoxyphenyl) N-(2-cyanoethyl)carbamate |
|---|---|
| PubChem CID | 116819885 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (2,3-dimethoxyphenyl) N-(2-cyanoethyl)carbamate |
| SMILES | COc1cccc(OC(=O)NCCC#N)c1OC |
| InChI | InChI=1S/C12H14N2O4/c1-16-9-5-3-6-10(11(9)17-2)18-12(15)14-8-4-7-13/h3,5-6H,4,8H2,1-2H3,(H,14,15) |
| InChIKey | XXGWHHIAYQYZSJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|