About [3-(2-chloroethoxy)-2-methoxyphenyl] N-methylcarbamate
[3-(2-chloroethoxy)-2-methoxyphenyl] N-methylcarbamate (PubChem CID 54442292) has the molecular formula C11H14ClNO4
and a molecular weight of 259.69 g/mol. Its IUPAC name is [3-(2-chloroethoxy)-2-methoxyphenyl] N-methylcarbamate.
Molecular Properties
| Compound Name | [3-(2-chloroethoxy)-2-methoxyphenyl] N-methylcarbamate |
| PubChem CID | 54442292 |
| Molecular Formula | C11H14ClNO4 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | [3-(2-chloroethoxy)-2-methoxyphenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc(OCCCl)c1OC |
| InChI | InChI=1S/C11H14ClNO4/c1-13-11(14)17-9-5-3-4-8(10(9)15-2)16-7-6-12/h3-5H,6-7H2,1-2H3,(H,13,14) |
| InChIKey | WOZDYICOSVBGOM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [3-(2-chloroethoxy)-2-methoxyphenyl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-chloroethoxy)-2-methoxyphenyl] N-methylcarbamate?
The IUPAC name of [3-(2-chloroethoxy)-2-methoxyphenyl] N-methylcarbamate (CID 54442292) is [3-(2-chloroethoxy)-2-methoxyphenyl] N-methylcarbamate.
What is the SMILES notation for [3-(2-chloroethoxy)-2-methoxyphenyl] N-methylcarbamate?
The canonical SMILES for [3-(2-chloroethoxy)-2-methoxyphenyl] N-methylcarbamate is CNC(=O)Oc1cccc(OCCCl)c1OC.
What is the InChIKey of [3-(2-chloroethoxy)-2-methoxyphenyl] N-methylcarbamate?
The InChIKey is WOZDYICOSVBGOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO4/c1-13-11(14)17-9-5-3-4-8(10(9)15-2)16-7-6-12/h3-5H,6-7H2,1-2H3,(H,13,14).
What are the key properties of [3-(2-chloroethoxy)-2-methoxyphenyl] N-methylcarbamate?
[3-(2-chloroethoxy)-2-methoxyphenyl] N-methylcarbamate has a molecular weight of 259.69 g/mol, XLogP of 2.03, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-chloroethoxy)-2-methoxyphenyl] N-methylcarbamate is sourced from PubChem (CID 54442292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).