About calcium;hydride;naphthalen-1-yl N-methylcarbamate
calcium;hydride;naphthalen-1-yl N-methylcarbamate (PubChem CID 173073118) has the molecular formula C12H13CaNO2
and a molecular weight of 243.32 g/mol. Its IUPAC name is calcium;hydride;naphthalen-1-yl N-methylcarbamate.
Molecular Properties
| Compound Name | calcium;hydride;naphthalen-1-yl N-methylcarbamate |
| PubChem CID | 173073118 |
| Molecular Formula | C12H13CaNO2 |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | calcium;hydride;naphthalen-1-yl N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc2ccccc12.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C12H11NO2.Ca.2H/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11;;;/h2-8H,1H3,(H,13,14);;;/q;+2;2*-1 |
| InChIKey | KVFQIMNXYJBILO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze calcium;hydride;naphthalen-1-yl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;naphthalen-1-yl N-methylcarbamate?
The IUPAC name of calcium;hydride;naphthalen-1-yl N-methylcarbamate (CID 173073118) is calcium;hydride;naphthalen-1-yl N-methylcarbamate.
What is the SMILES notation for calcium;hydride;naphthalen-1-yl N-methylcarbamate?
The canonical SMILES for calcium;hydride;naphthalen-1-yl N-methylcarbamate is CNC(=O)Oc1cccc2ccccc12.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;naphthalen-1-yl N-methylcarbamate?
The InChIKey is KVFQIMNXYJBILO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2.Ca.2H/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11;;;/h2-8H,1H3,(H,13,14);;;/q;+2;2*-1.
What are the key properties of calcium;hydride;naphthalen-1-yl N-methylcarbamate?
calcium;hydride;naphthalen-1-yl N-methylcarbamate has a molecular weight of 243.32 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;naphthalen-1-yl N-methylcarbamate is sourced from PubChem (CID 173073118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).