C11H15NO2 — CID 25550
(2,3,5-trimethylphenyl) N-methylcarbamate (PubChem CID 25550) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (2,3,5-trimethylphenyl) N-methylcarbamate.
| Compound Name | (2,3,5-trimethylphenyl) N-methylcarbamate |
|---|---|
| PubChem CID | 25550 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (2,3,5-trimethylphenyl) N-methylcarbamate |
| SMILES | CNC(=O)Oc1cc(C)cc(C)c1C |
| InChI | InChI=1S/C11H15NO2/c1-7-5-8(2)9(3)10(6-7)14-11(13)12-4/h5-6H,1-4H3,(H,12,13) |
| InChIKey | NYOKZHDTNBDPOB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |