C12H15NO6 — CID 67865616
(2,3-dimethoxyphenyl) 2-(methoxycarbonylamino)acetate (PubChem CID 67865616) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl) 2-(methoxycarbonylamino)acetate.
| Compound Name | (2,3-dimethoxyphenyl) 2-(methoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 67865616 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (2,3-dimethoxyphenyl) 2-(methoxycarbonylamino)acetate |
| SMILES | COC(=O)NCC(=O)Oc1cccc(OC)c1OC |
| InChI | InChI=1S/C12H15NO6/c1-16-8-5-4-6-9(11(8)17-2)19-10(14)7-13-12(15)18-3/h4-6H,7H2,1-3H3,(H,13,15) |
| InChIKey | ZDITZSVIZJSAOE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|